C16H10Cl2N2O4S — CID 75599513
5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(6-methoxy-3-pyridinyl)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 75599513) has the molecular formula C16H10Cl2N2O4S and a molecular weight of 397.24 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(6-methoxy-3-pyridinyl)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(6-methoxy-3-pyridinyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 75599513 |
| Molecular Formula | C16H10Cl2N2O4S |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(6-methoxy-3-pyridinyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)C(=Cc3cc(Cl)c(O)c(Cl)c3)OC2=S)cn1 |
| InChI | InChI=1S/C16H10Cl2N2O4S/c1-23-13-3-2-9(7-19-13)20-15(22)12(24-16(20)25)6-8-4-10(17)14(21)11(18)5-8/h2-7,21H,1H3 |
| InChIKey | PXBVOIABFRCHNF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|