C17H11Cl2NO4S — CID 70687587
(5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 70687587) has the molecular formula C17H11Cl2NO4S and a molecular weight of 396.25 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 70687587 |
| Molecular Formula | C17H11Cl2NO4S |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | (5Z)-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3cc(Cl)c(O)c(Cl)c3)OC2=S)cc1 |
| InChI | InChI=1S/C17H11Cl2NO4S/c1-23-11-4-2-10(3-5-11)20-16(22)14(24-17(20)25)8-9-6-12(18)15(21)13(19)7-9/h2-8,21H,1H3/b14-8- |
| InChIKey | ACBVTTLMNAZPEA-ZSOIEALJSA-N |
| XLogP | 4.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|