C15H12N4OS — CID 756031
2-(1,3-benzothiazol-2-ylamino)-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 756031) has the molecular formula C15H12N4OS and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 756031 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | O=C1CCCc2nc(Nc3nc4ccccc4s3)ncc21 |
| InChI | InChI=1S/C15H12N4OS/c20-12-6-3-5-10-9(12)8-16-14(17-10)19-15-18-11-4-1-2-7-13(11)21-15/h1-2,4,7-8H,3,5-6H2,(H,16,17,18,19) |
| InChIKey | HMMXXYPTFIGLOQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |