C20H21FN4O — CID 75603265
1-[4-[6-[(2-amino-2-phenylethyl)amino]pyrimidin-4-yl]-2-fluorophenyl]ethanol (PubChem CID 75603265) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[4-[6-[(2-amino-2-phenylethyl)amino]pyrimidin-4-yl]-2-fluorophenyl]ethanol.
| Compound Name | 1-[4-[6-[(2-amino-2-phenylethyl)amino]pyrimidin-4-yl]-2-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 75603265 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[4-[6-[(2-amino-2-phenylethyl)amino]pyrimidin-4-yl]-2-fluorophenyl]ethanol |
| SMILES | CC(O)c1ccc(-c2cc(NCC(N)c3ccccc3)ncn2)cc1F |
| InChI | InChI=1S/C20H21FN4O/c1-13(26)16-8-7-15(9-17(16)21)19-10-20(25-12-24-19)23-11-18(22)14-5-3-2-4-6-14/h2-10,12-13,18,26H,11,22H2,1H3,(H,23,24,25) |
| InChIKey | PQRZFDJDYVJBRE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |