C23H32FN6O6P — CID 75604711
heptyl 2-[[6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-fluoro-7-methyl-2-oxo-4a,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 75604711) has the molecular formula C23H32FN6O6P and a molecular weight of 538.52 g/mol. Its IUPAC name is heptyl 2-[[6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-fluoro-7-methyl-2-oxo-4a,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | heptyl 2-[[6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-fluoro-7-methyl-2-oxo-4a,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 75604711 |
| Molecular Formula | C23H32FN6O6P |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | heptyl 2-[[6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-cyano-7-fluoro-7-methyl-2-oxo-4a,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | CCCCCCCOC(=O)C(C)NP1(=O)OCC2OC(C#N)(c3ccc4c(N)ncnn34)C(C)(F)C2O1 |
| InChI | InChI=1S/C23H32FN6O6P/c1-4-5-6-7-8-11-33-21(31)15(2)29-37(32)34-12-17-19(36-37)22(3,24)23(13-25,35-17)18-10-9-16-20(26)27-14-28-30(16)18/h9-10,14-15,17,19H,4-8,11-12H2,1-3H3,(H,29,32)(H2,26,27,28) |
| InChIKey | HFIMLYPLQSSLAW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|