C28H34O14 — CID 75605114
[5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxan-4-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 75605114) has the molecular formula C28H34O14 and a molecular weight of 594.57 g/mol. Its IUPAC name is [5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxan-4-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxan-4-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 75605114 |
| Molecular Formula | C28H34O14 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [5-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxy-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxan-4-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1C(O)C(CO)OC(OCCc2ccc(O)cc2)C1OC1OCC(O)(CO)C1O |
| InChI | InChI=1S/C28H34O14/c29-12-20-22(35)23(41-21(34)8-4-16-3-7-18(32)19(33)11-16)24(42-27-25(36)28(37,13-30)14-39-27)26(40-20)38-10-9-15-1-5-17(31)6-2-15/h1-8,11,20,22-27,29-33,35-37H,9-10,12-14H2 |
| InChIKey | RHQIZJFLMIOHRF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|