C20H26O13 — CID 131751480
[6-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 131751480) has the molecular formula C20H26O13 and a molecular weight of 474.42 g/mol. Its IUPAC name is [6-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [6-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 131751480 |
| Molecular Formula | C20H26O13 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [6-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC1OC(COC2OCC(O)(CO)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C20H26O13/c21-7-20(29)8-31-19(17(20)28)30-6-12-14(25)15(26)16(27)18(32-12)33-13(24)4-2-9-1-3-10(22)11(23)5-9/h1-5,12,14-19,21-23,25-29H,6-8H2/b4-2+ |
| InChIKey | LULOGYYPGZOKQW-DUXPYHPUSA-N |
| XLogP | -3.08 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|