C25H36O13 — CID 162988675
[(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-pentan-2-yl]oxyoxan-2-yl]methoxy]oxolan-3-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162988675) has the molecular formula C25H36O13 and a molecular weight of 544.55 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-pentan-2-yl]oxyoxan-2-yl]methoxy]oxolan-3-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-pentan-2-yl]oxyoxan-2-yl]methoxy]oxolan-3-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162988675 |
| Molecular Formula | C25H36O13 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2S)-pentan-2-yl]oxyoxan-2-yl]methoxy]oxolan-3-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCC[C@H](C)O[C@@H]1O[C@H](CO[C@@H]2OC[C@](O)(COC(=O)C=Cc3ccc(O)c(O)c3)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H36O13/c1-3-4-13(2)37-23-21(31)20(30)19(29)17(38-23)10-34-24-22(32)25(33,12-36-24)11-35-18(28)8-6-14-5-7-15(26)16(27)9-14/h5-9,13,17,19-24,26-27,29-33H,3-4,10-12H2,1-2H3/t13-,17+,19+,20-,21+,22-,23+,24+,25+/m0/s1 |
| InChIKey | JEOODUYTNFLEHG-PUJDMGNKSA-N |
| XLogP | -0.87 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|