C14H15F3N2O3 — CID 75607730
5-methoxy-4-oxo-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide (PubChem CID 75607730) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 5-methoxy-4-oxo-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide.
| Compound Name | 5-methoxy-4-oxo-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 75607730 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5-methoxy-4-oxo-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C14H15F3N2O3/c1-22-12-7-18-10(6-11(12)20)13(21)19-9-4-2-8(3-5-9)14(15,16)17/h2-5,10,12,18H,6-7H2,1H3,(H,19,21) |
| InChIKey | QOJCMBREEXRBRM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |