C11H13Cl2N3O2 — CID 75611674
methyl N-[1-[[amino(phenyl)methylidene]amino]-2,2-dichloroethyl]carbamate (PubChem CID 75611674) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl N-[1-[[amino(phenyl)methylidene]amino]-2,2-dichloroethyl]carbamate.
| Compound Name | methyl N-[1-[[amino(phenyl)methylidene]amino]-2,2-dichloroethyl]carbamate |
|---|---|
| PubChem CID | 75611674 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl N-[1-[[amino(phenyl)methylidene]amino]-2,2-dichloroethyl]carbamate |
| SMILES | COC(=O)NC(N=C(N)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2N3O2/c1-18-11(17)16-10(8(12)13)15-9(14)7-5-3-2-4-6-7/h2-6,8,10H,1H3,(H2,14,15)(H,16,17) |
| InChIKey | XDZIHHXCCXYOEZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|