C11H9ClF6N2 — CID 174360754
N'-(3-chloro-1,1,1,4,4,4-hexafluorobutan-2-yl)benzenecarboximidamide (PubChem CID 174360754) has the molecular formula C11H9ClF6N2 and a molecular weight of 318.65 g/mol. Its IUPAC name is N'-(3-chloro-1,1,1,4,4,4-hexafluorobutan-2-yl)benzenecarboximidamide.
| Compound Name | N'-(3-chloro-1,1,1,4,4,4-hexafluorobutan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 174360754 |
| Molecular Formula | C11H9ClF6N2 |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N'-(3-chloro-1,1,1,4,4,4-hexafluorobutan-2-yl)benzenecarboximidamide |
| SMILES | N/C(=N/C(C(Cl)C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H9ClF6N2/c12-7(10(13,14)15)8(11(16,17)18)20-9(19)6-4-2-1-3-5-6/h1-5,7-8H,(H2,19,20) |
| InChIKey | XRSZCHUCWRVTNQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|