C17H22N5O+ — CID 7561994
4-(4-ethylpiperazin-4-ium-1-yl)-9-methoxy-5H-pyrimido[5,4-b]indole (PubChem CID 7561994) has the molecular formula C17H22N5O+ and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-4-ium-1-yl)-9-methoxy-5H-pyrimido[5,4-b]indole.
| Compound Name | 4-(4-ethylpiperazin-4-ium-1-yl)-9-methoxy-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 7561994 |
| Molecular Formula | C17H22N5O+ |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-(4-ethylpiperazin-4-ium-1-yl)-9-methoxy-5H-pyrimido[5,4-b]indole |
| SMILES | CC[NH+]1CCN(c2ncnc3c2[nH]c2cccc(OC)c23)CC1 |
| InChI | InChI=1S/C17H21N5O/c1-3-21-7-9-22(10-8-21)17-16-15(18-11-19-17)14-12(20-16)5-4-6-13(14)23-2/h4-6,11,20H,3,7-10H2,1-2H3/p+1 |
| InChIKey | ZKDGNKFUPKUXQG-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |