C23H18F2N2O3 — CID 7562134
(5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-phenoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 7562134) has the molecular formula C23H18F2N2O3 and a molecular weight of 408.40 g/mol. Its IUPAC name is (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-phenoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-phenoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7562134 |
| Molecular Formula | C23H18F2N2O3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-phenoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cc(F)ccc2F)NC(=O)N(Cc2ccccc2Oc2ccccc2)C1=O |
| InChI | InChI=1S/C23H18F2N2O3/c1-23(18-13-16(24)11-12-19(18)25)21(28)27(22(29)26-23)14-15-7-5-6-10-20(15)30-17-8-3-2-4-9-17/h2-13H,14H2,1H3,(H,26,29)/t23-/m1/s1 |
| InChIKey | YOPJQABZHPUBOV-HSZRJFAPSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|