C18H17FN6 — CID 75637357
4-[5-(4-fluorophenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline (PubChem CID 75637357) has the molecular formula C18H17FN6 and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(4-fluorophenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 75637357 |
| Molecular Formula | C18H17FN6 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(F)cc3)=Nc3nnnn32)cc1 |
| InChI | InChI=1S/C18H17FN6/c1-24(2)15-9-5-13(6-10-15)17-11-16(12-3-7-14(19)8-4-12)20-18-21-22-23-25(17)18/h3-10,17H,11H2,1-2H3 |
| InChIKey | DPPIATNRAANULF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|