C18H18N2O4 — CID 75641961
2-(3-hydroxyphenyl)-9-methoxy-1,2,3,4a,5,10a-hexahydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 75641961) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-9-methoxy-1,2,3,4a,5,10a-hexahydrochromeno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(3-hydroxyphenyl)-9-methoxy-1,2,3,4a,5,10a-hexahydrochromeno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75641961 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(3-hydroxyphenyl)-9-methoxy-1,2,3,4a,5,10a-hexahydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | COc1cccc2c1OC1NC(c3cccc(O)c3)NC(=O)C1C2 |
| InChI | InChI=1S/C18H18N2O4/c1-23-14-7-3-4-10-9-13-17(22)19-16(20-18(13)24-15(10)14)11-5-2-6-12(21)8-11/h2-8,13,16,18,20-21H,9H2,1H3,(H,19,22) |
| InChIKey | MCUCVHUDQLSATL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |