C15H17N3O2S — CID 75683798
6-[(2-methoxyphenyl)methyl]-2-sulfanylidene-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 75683798) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methyl]-2-sulfanylidene-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-methoxyphenyl)methyl]-2-sulfanylidene-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75683798 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 6-[(2-methoxyphenyl)methyl]-2-sulfanylidene-4a,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1CN1CCC2=NC(=S)NC(=O)C2C1 |
| InChI | InChI=1S/C15H17N3O2S/c1-20-13-5-3-2-4-10(13)8-18-7-6-12-11(9-18)14(19)17-15(21)16-12/h2-5,11H,6-9H2,1H3,(H,17,19,21) |
| InChIKey | UZSPHFIGZOHTRJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|