C32H28N4O2 — CID 75731928
1-(5-phenylmethoxy-2-pyridinyl)-N-[(1S)-1-phenyl-2-[(6-pyridin-2-yl-3-pyridinyl)methoxy]ethyl]methanimine (PubChem CID 75731928) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-(5-phenylmethoxy-2-pyridinyl)-N-[(1S)-1-phenyl-2-[(6-pyridin-2-yl-3-pyridinyl)methoxy]ethyl]methanimine.
| Compound Name | 1-(5-phenylmethoxy-2-pyridinyl)-N-[(1S)-1-phenyl-2-[(6-pyridin-2-yl-3-pyridinyl)methoxy]ethyl]methanimine |
|---|---|
| PubChem CID | 75731928 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-(5-phenylmethoxy-2-pyridinyl)-N-[(1S)-1-phenyl-2-[(6-pyridin-2-yl-3-pyridinyl)methoxy]ethyl]methanimine |
| SMILES | C(=N/[C@H](COCc1ccc(-c2ccccn2)nc1)c1ccccc1)\c1ccc(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C32H28N4O2/c1-3-9-25(10-4-1)23-38-29-16-15-28(34-21-29)20-36-32(27-11-5-2-6-12-27)24-37-22-26-14-17-31(35-19-26)30-13-7-8-18-33-30/h1-21,32H,22-24H2/b36-20+/t32-/m1/s1 |
| InChIKey | UYZGIODEBHYYPV-YWWZPSMVSA-N |
| XLogP | 6.49 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|