C23H25N3O4 — CID 7573480
[2-(4-ethylanilino)-2-oxoethyl] (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate (PubChem CID 7573480) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl] (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl] (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 7573480 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl] (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate |
| SMILES | CCc1ccc(NC(=O)COC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(C)=O)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-3-16-8-10-18(11-9-16)26-22(28)14-30-23(29)21(25-15(2)27)12-17-13-24-20-7-5-4-6-19(17)20/h4-11,13,21,24H,3,12,14H2,1-2H3,(H,25,27)(H,26,28)/t21-/m0/s1 |
| InChIKey | MMCITSZQTVSMPH-NRFANRHFSA-N |
| XLogP | 2.96 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |