C24H29N5O4 — CID 40858233
[2-[4-(diethylamino)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 40858233) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 40858233 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] (2R)-2-(carbamoylamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | CCN(CC)c1ccc(NC(=O)COC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(N)=O)cc1 |
| InChI | InChI=1S/C24H29N5O4/c1-3-29(4-2)18-11-9-17(10-12-18)27-22(30)15-33-23(31)21(28-24(25)32)13-16-14-26-20-8-6-5-7-19(16)20/h5-12,14,21,26H,3-4,13,15H2,1-2H3,(H,27,30)(H3,25,28,32)/t21-/m1/s1 |
| InChIKey | DWHDAOFADPAZNX-OAQYLSRUSA-N |
| XLogP | 2.78 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|