C18H18FNO5 — CID 7576658
(3-fluoro-4-methoxyphenyl)methyl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7576658) has the molecular formula C18H18FNO5 and a molecular weight of 347.34 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7576658 |
| Molecular Formula | C18H18FNO5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(COC(=O)[C@H]2CC(=O)N(Cc3ccco3)C2)cc1F |
| InChI | InChI=1S/C18H18FNO5/c1-23-16-5-4-12(7-15(16)19)11-25-18(22)13-8-17(21)20(9-13)10-14-3-2-6-24-14/h2-7,13H,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | IBINADHVJYEMAA-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |