C7H11N3OS — CID 7576669
4-methyl-N-propylthiadiazole-5-carboxamide (PubChem CID 7576669) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-methyl-N-propylthiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7576669 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 4-methyl-N-propylthiadiazole-5-carboxamide |
| SMILES | CCCNC(=O)c1snnc1C |
| InChI | InChI=1S/C7H11N3OS/c1-3-4-8-7(11)6-5(2)9-10-12-6/h3-4H2,1-2H3,(H,8,11) |
| InChIKey | GLLXKBGKVSOVAK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |