C8H13N3OS — CID 7576675
4-methyl-N-(2-methylpropyl)thiadiazole-5-carboxamide (PubChem CID 7576675) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 4-methyl-N-(2-methylpropyl)thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(2-methylpropyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7576675 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-methyl-N-(2-methylpropyl)thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCC(C)C |
| InChI | InChI=1S/C8H13N3OS/c1-5(2)4-9-8(12)7-6(3)10-11-13-7/h5H,4H2,1-3H3,(H,9,12) |
| InChIKey | WVVIQPHJYLUECE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |