C18H11N5O — CID 757689
2-(1,3-benzoxazol-2-ylamino)-4-phenylpyrimidine-5-carbonitrile (PubChem CID 757689) has the molecular formula C18H11N5O and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-4-phenylpyrimidine-5-carbonitrile.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-4-phenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 757689 |
| Molecular Formula | C18H11N5O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-4-phenylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(Nc2nc3ccccc3o2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H11N5O/c19-10-13-11-20-17(22-16(13)12-6-2-1-3-7-12)23-18-21-14-8-4-5-9-15(14)24-18/h1-9,11H,(H,20,21,22,23) |
| InChIKey | ASNDNIVCIYLZAQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |