C18H14N2 — CID 757851
3-methyl-2-phenylimidazo[2,1-a]isoquinoline (PubChem CID 757851) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-methyl-2-phenylimidazo[2,1-a]isoquinoline.
| Compound Name | 3-methyl-2-phenylimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 757851 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-methyl-2-phenylimidazo[2,1-a]isoquinoline |
| SMILES | Cc1c(-c2ccccc2)nc2c3ccccc3ccn12 |
| InChI | InChI=1S/C18H14N2/c1-13-17(15-8-3-2-4-9-15)19-18-16-10-6-5-7-14(16)11-12-20(13)18/h2-12H,1H3 |
| InChIKey | AZSVMMHTRNMWNY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |