C13H13N3 — CID 115027407
(2-methylimidazo[2,1-a]isoquinolin-3-yl)methanamine (PubChem CID 115027407) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is (2-methylimidazo[2,1-a]isoquinolin-3-yl)methanamine.
| Compound Name | (2-methylimidazo[2,1-a]isoquinolin-3-yl)methanamine |
|---|---|
| PubChem CID | 115027407 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2-methylimidazo[2,1-a]isoquinolin-3-yl)methanamine |
| SMILES | Cc1nc2c3ccccc3ccn2c1CN |
| InChI | InChI=1S/C13H13N3/c1-9-12(8-14)16-7-6-10-4-2-3-5-11(10)13(16)15-9/h2-7H,8,14H2,1H3 |
| InChIKey | OPLVOEQRGIJOHB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |