C16H15NO5 — CID 75793943
4-hydroxy-1-methyl-3-(5-methylfuran-2-carbonyl)-2-(5-methylfuran-2-yl)-2H-pyrrol-5-one (PubChem CID 75793943) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-(5-methylfuran-2-carbonyl)-2-(5-methylfuran-2-yl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-methyl-3-(5-methylfuran-2-carbonyl)-2-(5-methylfuran-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 75793943 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-hydroxy-1-methyl-3-(5-methylfuran-2-carbonyl)-2-(5-methylfuran-2-yl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(C(=O)C2=C(O)C(=O)N(C)C2c2ccc(C)o2)o1 |
| InChI | InChI=1S/C16H15NO5/c1-8-4-6-10(21-8)13-12(15(19)16(20)17(13)3)14(18)11-7-5-9(2)22-11/h4-7,13,19H,1-3H3 |
| InChIKey | HYLSAAZGELOPRG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |