C19H18N2O5 — CID 75795914
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75795914) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75795914 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(NC(=O)C1(C)Oc2ccccc2NC1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N2O5/c1-11(12-7-8-15-16(9-12)25-10-24-15)20-17(22)19(2)18(23)21-13-5-3-4-6-14(13)26-19/h3-9,11H,10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | USTPEKSZEMKGJK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|