C22H23NO5 — CID 75796722
N-[1-(4-methoxyphenyl)ethyl]-2-oxo-7-propan-2-yloxychromene-4-carboxamide (PubChem CID 75796722) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-2-oxo-7-propan-2-yloxychromene-4-carboxamide.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-2-oxo-7-propan-2-yloxychromene-4-carboxamide |
|---|---|
| PubChem CID | 75796722 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-2-oxo-7-propan-2-yloxychromene-4-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cc(=O)oc3cc(OC(C)C)ccc23)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-13(2)27-17-9-10-18-19(12-21(24)28-20(18)11-17)22(25)23-14(3)15-5-7-16(26-4)8-6-15/h5-14H,1-4H3,(H,23,25) |
| InChIKey | JGMSGEPXMRKISD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|