C19H30N2O4S — CID 75807755
N-ethyl-1-ethylsulfonyl-N-[1-(3-methoxyphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 75807755) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-ethyl-1-ethylsulfonyl-N-[1-(3-methoxyphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-ethylsulfonyl-N-[1-(3-methoxyphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 75807755 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-ethyl-1-ethylsulfonyl-N-[1-(3-methoxyphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCN(C(=O)C1CCN(S(=O)(=O)CC)CC1)C(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H30N2O4S/c1-5-21(15(3)17-8-7-9-18(14-17)25-4)19(22)16-10-12-20(13-11-16)26(23,24)6-2/h7-9,14-16H,5-6,10-13H2,1-4H3 |
| InChIKey | AXDGALHZGKGYDJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |