C14H18N3O4- — CID 7582097
(2S)-2-[(3-acetamidophenyl)carbamoylamino]-3-methylbutanoate (PubChem CID 7582097) has the molecular formula C14H18N3O4- and a molecular weight of 292.32 g/mol. Its IUPAC name is (2S)-2-[(3-acetamidophenyl)carbamoylamino]-3-methylbutanoate.
| Compound Name | (2S)-2-[(3-acetamidophenyl)carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7582097 |
| Molecular Formula | C14H18N3O4- |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (2S)-2-[(3-acetamidophenyl)carbamoylamino]-3-methylbutanoate |
| SMILES | CC(=O)Nc1cccc(NC(=O)N[C@H](C(=O)[O-])C(C)C)c1 |
| InChI | InChI=1S/C14H19N3O4/c1-8(2)12(13(19)20)17-14(21)16-11-6-4-5-10(7-11)15-9(3)18/h4-8,12H,1-3H3,(H,15,18)(H,19,20)(H2,16,17,21)/p-1/t12-/m0/s1 |
| InChIKey | WEIKULVZJRFOMG-LBPRGKRZSA-M |
| XLogP | 0.54 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |