C11H14N6O2S — CID 75866971
4-methoxy-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpyrimidine (PubChem CID 75866971) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-methoxy-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpyrimidine.
| Compound Name | 4-methoxy-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpyrimidine |
|---|---|
| PubChem CID | 75866971 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-methoxy-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpyrimidine |
| SMILES | COc1ccnc(Sc2nnnn2CC2CCCO2)n1 |
| InChI | InChI=1S/C11H14N6O2S/c1-18-9-4-5-12-10(13-9)20-11-14-15-16-17(11)7-8-3-2-6-19-8/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | BJMZHLPERFTEHL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |