C14H20N2O2 — CID 75871769
2-acetamido-N-[(2,4-dimethylphenyl)methyl]propanamide (PubChem CID 75871769) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-acetamido-N-[(2,4-dimethylphenyl)methyl]propanamide.
| Compound Name | 2-acetamido-N-[(2,4-dimethylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 75871769 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-acetamido-N-[(2,4-dimethylphenyl)methyl]propanamide |
| SMILES | CC(=O)NC(C)C(=O)NCc1ccc(C)cc1C |
| InChI | InChI=1S/C14H20N2O2/c1-9-5-6-13(10(2)7-9)8-15-14(18)11(3)16-12(4)17/h5-7,11H,8H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | GLWFXLFGOHOKJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |