C20H25FN2O2 — CID 75878457
2-[ethyl-[1-(3-methoxyphenyl)ethyl]amino]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 75878457) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[ethyl-[1-(3-methoxyphenyl)ethyl]amino]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[ethyl-[1-(3-methoxyphenyl)ethyl]amino]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 75878457 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[ethyl-[1-(3-methoxyphenyl)ethyl]amino]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccccc1F)C(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H25FN2O2/c1-4-23(15(2)16-9-7-10-18(12-16)25-3)14-20(24)22-13-17-8-5-6-11-19(17)21/h5-12,15H,4,13-14H2,1-3H3,(H,22,24) |
| InChIKey | BESXKWMSQYBCHG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |