C19H14FN3O3 — CID 75896601
N-[4-fluoro-2-[3-(furan-2-yl)prop-2-enoylamino]phenyl]pyridine-2-carboxamide (PubChem CID 75896601) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[4-fluoro-2-[3-(furan-2-yl)prop-2-enoylamino]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-fluoro-2-[3-(furan-2-yl)prop-2-enoylamino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 75896601 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[4-fluoro-2-[3-(furan-2-yl)prop-2-enoylamino]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(C=Cc1ccco1)Nc1cc(F)ccc1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C19H14FN3O3/c20-13-6-8-15(23-19(25)16-5-1-2-10-21-16)17(12-13)22-18(24)9-7-14-4-3-11-26-14/h1-12H,(H,22,24)(H,23,25) |
| InChIKey | LTCOAGYFXBQTSP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|