C19H23ClN3O3+ — CID 7590998
(2S)-2-[2-(benzylazaniumyl)ethylazaniumyl]-4-(4-chloroanilino)-4-oxobutanoate (PubChem CID 7590998) has the molecular formula C19H23ClN3O3+ and a molecular weight of 376.86 g/mol. Its IUPAC name is (2S)-2-[2-(benzylazaniumyl)ethylazaniumyl]-4-(4-chloroanilino)-4-oxobutanoate.
| Compound Name | (2S)-2-[2-(benzylazaniumyl)ethylazaniumyl]-4-(4-chloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7590998 |
| Molecular Formula | C19H23ClN3O3+ |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S)-2-[2-(benzylazaniumyl)ethylazaniumyl]-4-(4-chloroanilino)-4-oxobutanoate |
| SMILES | O=C(C[C@H]([NH2+]CC[NH2+]Cc1ccccc1)C(=O)[O-])Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O3/c20-15-6-8-16(9-7-15)23-18(24)12-17(19(25)26)22-11-10-21-13-14-4-2-1-3-5-14/h1-9,17,21-22H,10-13H2,(H,23,24)(H,25,26)/p+1/t17-/m0/s1 |
| InChIKey | GOMGBOCNSJCETR-KRWDZBQOSA-O |
| XLogP | -0.89 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|