C17H27N4O5+ — CID 7592351
(2R)-2-[2-(diethylazaniumyl)ethylazaniumyl]-4-(4-methyl-2-nitroanilino)-4-oxobutanoate (PubChem CID 7592351) has the molecular formula C17H27N4O5+ and a molecular weight of 367.43 g/mol. Its IUPAC name is (2R)-2-[2-(diethylazaniumyl)ethylazaniumyl]-4-(4-methyl-2-nitroanilino)-4-oxobutanoate.
| Compound Name | (2R)-2-[2-(diethylazaniumyl)ethylazaniumyl]-4-(4-methyl-2-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7592351 |
| Molecular Formula | C17H27N4O5+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R)-2-[2-(diethylazaniumyl)ethylazaniumyl]-4-(4-methyl-2-nitroanilino)-4-oxobutanoate |
| SMILES | CC[NH+](CC)CC[NH2+][C@H](CC(=O)Nc1ccc(C)cc1[N+](=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C17H26N4O5/c1-4-20(5-2)9-8-18-14(17(23)24)11-16(22)19-13-7-6-12(3)10-15(13)21(25)26/h6-7,10,14,18H,4-5,8-9,11H2,1-3H3,(H,19,22)(H,23,24)/p+1/t14-/m1/s1 |
| InChIKey | VPRRXXTZJPNHEO-CQSZACIVSA-O |
| XLogP | -2.16 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|