C18H19N5O4S — CID 75937370
methyl 3-(4-methylphenyl)-3-[[3-(tetrazol-1-yl)phenyl]sulfonylamino]propanoate (PubChem CID 75937370) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is methyl 3-(4-methylphenyl)-3-[[3-(tetrazol-1-yl)phenyl]sulfonylamino]propanoate.
| Compound Name | methyl 3-(4-methylphenyl)-3-[[3-(tetrazol-1-yl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 75937370 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 3-(4-methylphenyl)-3-[[3-(tetrazol-1-yl)phenyl]sulfonylamino]propanoate |
| SMILES | COC(=O)CC(NS(=O)(=O)c1cccc(-n2cnnn2)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N5O4S/c1-13-6-8-14(9-7-13)17(11-18(24)27-2)20-28(25,26)16-5-3-4-15(10-16)23-12-19-21-22-23/h3-10,12,17,20H,11H2,1-2H3 |
| InChIKey | DWHQCWJLYNWWJE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |