C15H10N4 — CID 759406
10H-indeno[2,3-b]quinoxalin-11-yldiazene (PubChem CID 759406) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 10H-indeno[2,3-b]quinoxalin-11-yldiazene.
| Compound Name | 10H-indeno[2,3-b]quinoxalin-11-yldiazene |
|---|---|
| PubChem CID | 759406 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 10H-indeno[2,3-b]quinoxalin-11-yldiazene |
| SMILES | [H]/N=N/c1c2[nH]c3ccccc3nc-2c2ccccc12 |
| InChI | InChI=1S/C15H10N4/c16-19-14-10-6-2-1-5-9(10)13-15(14)18-12-8-4-3-7-11(12)17-13/h1-8,16,18H/b19-16+ |
| InChIKey | NSMZCJURXJITIE-KNTRCKAVSA-N |
| XLogP | 4.48 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|