About 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide
5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide (PubChem CID 135840801) has the molecular formula C20H11BrN4O2
and a molecular weight of 419.24 g/mol. Its IUPAC name is 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide |
| PubChem CID | 135840801 |
| Molecular Formula | C20H11BrN4O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide |
| SMILES | O=C(/N=N/c1c2[nH]c3ccccc3nc-2c2ccccc12)c1ccc(Br)o1 |
| InChI | InChI=1S/C20H11BrN4O2/c21-16-10-9-15(27-16)20(26)25-24-18-12-6-2-1-5-11(12)17-19(18)23-14-8-4-3-7-13(14)22-17/h1-10,23H/b25-24+ |
| InChIKey | PPOBYRXIAZPHRE-OCOZRVBESA-N |
| XLogP | 6.10 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide?
The IUPAC name of 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide (CID 135840801) is 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide?
The canonical SMILES for 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide is O=C(/N=N/c1c2[nH]c3ccccc3nc-2c2ccccc12)c1ccc(Br)o1.
What is the InChIKey of 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide?
The InChIKey is PPOBYRXIAZPHRE-OCOZRVBESA-N. The full InChI is InChI=1S/C20H11BrN4O2/c21-16-10-9-15(27-16)20(26)25-24-18-12-6-2-1-5-11(12)17-19(18)23-14-8-4-3-7-13(14)22-17/h1-10,23H/b25-24+.
What are the key properties of 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide?
5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide has a molecular weight of 419.24 g/mol, XLogP of 6.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(10H-indeno[2,3-b]quinoxalin-11-ylimino)furan-2-carboxamide is sourced from PubChem (CID 135840801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).