C21H17NO5 — CID 75953931
4-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]-1,4-benzoxazin-3-one (PubChem CID 75953931) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75953931 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]-1,4-benzoxazin-3-one |
| SMILES | C#CCOc1ccc(C=CC(=O)N2C(=O)COc3ccccc32)cc1OC |
| InChI | InChI=1S/C21H17NO5/c1-3-12-26-18-10-8-15(13-19(18)25-2)9-11-20(23)22-16-6-4-5-7-17(16)27-14-21(22)24/h1,4-11,13H,12,14H2,2H3 |
| InChIKey | CLVJTTTWLUQBQC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|