C47H72NO8P — CID 75957827
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-icosa-5,8,11,14,17-pentaenoyloxypropyl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 75957827) has the molecular formula C47H72NO8P and a molecular weight of 810.07 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-icosa-5,8,11,14,17-pentaenoyloxypropyl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-icosa-5,8,11,14,17-pentaenoyloxypropyl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 75957827 |
| Molecular Formula | C47H72NO8P |
| Molecular Weight | 810.07 g/mol |
| Exact Mass | 809.50 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-icosa-5,8,11,14,17-pentaenoyloxypropyl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C47H72NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-25-27-29-31-33-35-37-39-46(49)53-43-45(44-55-57(51,52)54-42-41-48)56-47(50)40-38-36-34-32-30-28-26-23-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,22,24,26-29,32-35,45H,3-4,9-10,15-16,21,23,25,30-31,36-44,48H2,1-2H3,(H,51,52) |
| InChIKey | CTRNDOXRTRKMSK-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.07 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|