C47H74NO8P — CID 162991492
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 162991492) has the molecular formula C47H74NO8P and a molecular weight of 812.08 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 162991492 |
| Molecular Formula | C47H74NO8P |
| Molecular Weight | 812.08 g/mol |
| Exact Mass | 811.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-icosa-5,8,11,14-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O[C@H](COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C47H74NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-47(50)56-45(44-55-57(51,52)54-42-41-48)43-53-46(49)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,22,24-25,27-28,30-31,33-34,36,45H,3-4,6,8-10,15-16,21,23,26,29,32,35,37-44,48H2,1-2H3,(H,51,52)/t45-/m1/s1 |
| InChIKey | KXAGMEXWNHUIQR-WBVITSLISA-N |
| XLogP | 12.16 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.08 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|