C44H74NO10P — CID 75958633
2-amino-3-[hydroxy-(3-icosa-8,11,14-trienoyloxy-2-octadeca-9,12,15-trienoyloxypropoxy)phosphoryl]oxypropanoic acid (PubChem CID 75958633) has the molecular formula C44H74NO10P and a molecular weight of 808.05 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-(3-icosa-8,11,14-trienoyloxy-2-octadeca-9,12,15-trienoyloxypropoxy)phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-(3-icosa-8,11,14-trienoyloxy-2-octadeca-9,12,15-trienoyloxypropoxy)phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 75958633 |
| Molecular Formula | C44H74NO10P |
| Molecular Weight | 808.05 g/mol |
| Exact Mass | 807.51 |
| IUPAC Name | 2-amino-3-[hydroxy-(3-icosa-8,11,14-trienoyloxy-2-octadeca-9,12,15-trienoyloxypropoxy)phosphoryl]oxypropanoic acid |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C44H74NO10P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(46)52-37-40(38-53-56(50,51)54-39-41(45)44(48)49)55-43(47)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-19,21-23,40-41H,3-5,7,9-10,15-16,20,24-39,45H2,1-2H3,(H,48,49)(H,50,51) |
| InChIKey | QRNALORMYKHPSS-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.05 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|