C16H15F3N2O3S2 — CID 7596386
N-[(3aR,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide (PubChem CID 7596386) has the molecular formula C16H15F3N2O3S2 and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[(3aR,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide.
| Compound Name | N-[(3aR,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 7596386 |
| Molecular Formula | C16H15F3N2O3S2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[(3aR,6aR)-5,5-dioxo-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]cyclopropanecarboxamide |
| SMILES | O=C(/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C16H15F3N2O3S2/c17-16(18,19)10-2-1-3-11(6-10)21-12-7-26(23,24)8-13(12)25-15(21)20-14(22)9-4-5-9/h1-3,6,9,12-13H,4-5,7-8H2/b20-15-/t12-,13+/m1/s1 |
| InChIKey | VLAPYUISKPAMPQ-SDJGWGIBSA-N |
| XLogP | 2.72 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|