C20H26N3O2S+ — CID 7596816
2-[[2-(2,4-dimethylphenyl)acetyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7596816) has the molecular formula C20H26N3O2S+ and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethylphenyl)acetyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 2-[[2-(2,4-dimethylphenyl)acetyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7596816 |
| Molecular Formula | C20H26N3O2S+ |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[[2-(2,4-dimethylphenyl)acetyl]amino]-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | CC[NH+]1CCc2c(sc(NC(=O)Cc3ccc(C)cc3C)c2C(N)=O)C1 |
| InChI | InChI=1S/C20H25N3O2S/c1-4-23-8-7-15-16(11-23)26-20(18(15)19(21)25)22-17(24)10-14-6-5-12(2)9-13(14)3/h5-6,9H,4,7-8,10-11H2,1-3H3,(H2,21,25)(H,22,24)/p+1 |
| InChIKey | WHYWACYPIKYAKE-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |