C15H23N3O2S — CID 7597436
(5S)-5-(cyclohexylmethyliminomethyl)-1-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7597436) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (5S)-5-(cyclohexylmethyliminomethyl)-1-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-5-(cyclohexylmethyliminomethyl)-1-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7597436 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (5S)-5-(cyclohexylmethyliminomethyl)-1-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1C(=O)[C@@H](/C=N/CC2CCCCC2)C(=O)NC1=S |
| InChI | InChI=1S/C15H23N3O2S/c1-2-8-18-14(20)12(13(19)17-15(18)21)10-16-9-11-6-4-3-5-7-11/h10-12H,2-9H2,1H3,(H,17,19,21)/b16-10+/t12-/m0/s1 |
| InChIKey | RKNBAFMFDAJIHH-SEJMYLSOSA-N |
| XLogP | 1.91 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|