C20H16Cl2N4OS — CID 75978246
2-[1-chloro-2-[1-(2-chloroethyl)pyrazol-4-yl]ethenyl]-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 75978246) has the molecular formula C20H16Cl2N4OS and a molecular weight of 431.35 g/mol. Its IUPAC name is 2-[1-chloro-2-[1-(2-chloroethyl)pyrazol-4-yl]ethenyl]-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-chloro-2-[1-(2-chloroethyl)pyrazol-4-yl]ethenyl]-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75978246 |
| Molecular Formula | C20H16Cl2N4OS |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-[1-chloro-2-[1-(2-chloroethyl)pyrazol-4-yl]ethenyl]-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(C(Cl)=Cc3cnn(CCCl)c3)[nH]c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C20H16Cl2N4OS/c1-12-16(14-5-3-2-4-6-14)17-19(27)24-18(25-20(17)28-12)15(22)9-13-10-23-26(11-13)8-7-21/h2-6,9-11H,7-8H2,1H3,(H,24,25,27) |
| InChIKey | XCEDORFOGSDJNF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|