C23H33NO5S — CID 75987024
10-hydroxy-N-methoxy-1,1,4a,10b-tetramethyl-6,6-dioxo-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene-8-carboxamide (PubChem CID 75987024) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is 10-hydroxy-N-methoxy-1,1,4a,10b-tetramethyl-6,6-dioxo-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene-8-carboxamide.
| Compound Name | 10-hydroxy-N-methoxy-1,1,4a,10b-tetramethyl-6,6-dioxo-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene-8-carboxamide |
|---|---|
| PubChem CID | 75987024 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 10-hydroxy-N-methoxy-1,1,4a,10b-tetramethyl-6,6-dioxo-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]thiochromene-8-carboxamide |
| SMILES | CONC(=O)c1cc(O)c2c(c1)S(=O)(=O)CC1C2(C)CCC2C(C)(C)CCCC21C |
| InChI | InChI=1S/C23H33NO5S/c1-21(2)8-6-9-22(3)17(21)7-10-23(4)18(22)13-30(27,28)16-12-14(20(26)24-29-5)11-15(25)19(16)23/h11-12,17-18,25H,6-10,13H2,1-5H3,(H,24,26) |
| InChIKey | WLLLZCXNTJPKCH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|