C14H11N3 — CID 759888
1,5-diphenyl-1,2,4-triazole (PubChem CID 759888) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1,5-diphenyl-1,2,4-triazole.
| Compound Name | 1,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 759888 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1,5-diphenyl-1,2,4-triazole |
| SMILES | c1ccc(-c2ncnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11N3/c1-3-7-12(8-4-1)14-15-11-16-17(14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | UWVIKPAJVSOFLA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |