C23H28NO4+ — CID 7601809
1-[(6R,7R,8R)-8-(4-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidin-1-ium (PubChem CID 7601809) has the molecular formula C23H28NO4+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[(6R,7R,8R)-8-(4-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidin-1-ium.
| Compound Name | 1-[(6R,7R,8R)-8-(4-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 7601809 |
| Molecular Formula | C23H28NO4+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-[(6R,7R,8R)-8-(4-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-yl]pyrrolidin-1-ium |
| SMILES | COc1ccc([C@@H]2c3cc4c(cc3O[C@@](C)([NH+]3CCCC3)[C@@H]2C)OCO4)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-15-22(16-6-8-17(25-3)9-7-16)18-12-20-21(27-14-26-20)13-19(18)28-23(15,2)24-10-4-5-11-24/h6-9,12-13,15,22H,4-5,10-11,14H2,1-3H3/p+1/t15-,22-,23-/m1/s1 |
| InChIKey | HIXCOBNUFVJSMU-DURYTUKUSA-O |
| XLogP | 2.98 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |